About 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate
1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate (PubChem CID 50900779) has the molecular formula C12H18FNO6
and a molecular weight of 291.28 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate |
| PubChem CID | 50900779 |
| Molecular Formula | C12H18FNO6 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate |
| SMILES | CCOC(=O)C(F)(C[C@H](NC(C)=O)C(=O)OC)C(C)=O |
| InChI | InChI=1S/C12H18FNO6/c1-5-20-11(18)12(13,7(2)15)6-9(10(17)19-4)14-8(3)16/h9H,5-6H2,1-4H3,(H,14,16)/t9-,12?/m0/s1 |
| InChIKey | IWDUQUAEEVYGRN-QHGLUPRGSA-N |
| XLogP | -0.09 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate?
The IUPAC name of 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate (CID 50900779) is 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate.
What is the SMILES notation for 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate?
The canonical SMILES for 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate is CCOC(=O)C(F)(C[C@H](NC(C)=O)C(=O)OC)C(C)=O.
What is the InChIKey of 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate?
The InChIKey is IWDUQUAEEVYGRN-QHGLUPRGSA-N. The full InChI is InChI=1S/C12H18FNO6/c1-5-20-11(18)12(13,7(2)15)6-9(10(17)19-4)14-8(3)16/h9H,5-6H2,1-4H3,(H,14,16)/t9-,12?/m0/s1.
What are the key properties of 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate?
1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate has a molecular weight of 291.28 g/mol, XLogP of -0.09, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 5-O-methyl (4S)-4-acetamido-2-acetyl-2-fluoropentanedioate is sourced from PubChem (CID 50900779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).