C15H24O3Si — CID 50901423
(1S,4R,6S,12S)-6-hydroxy-6-methyl-8-trimethylsilyl-3-oxatricyclo[5.4.1.04,12]dodec-7-en-2-one (PubChem CID 50901423) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is (1S,4R,6S,12S)-6-hydroxy-6-methyl-8-trimethylsilyl-3-oxatricyclo[5.4.1.04,12]dodec-7-en-2-one.
| Compound Name | (1S,4R,6S,12S)-6-hydroxy-6-methyl-8-trimethylsilyl-3-oxatricyclo[5.4.1.04,12]dodec-7-en-2-one |
|---|---|
| PubChem CID | 50901423 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (1S,4R,6S,12S)-6-hydroxy-6-methyl-8-trimethylsilyl-3-oxatricyclo[5.4.1.04,12]dodec-7-en-2-one |
| SMILES | C[C@]1(O)C[C@H]2OC(=O)[C@H]3CCCC([Si](C)(C)C)=C1[C@H]32 |
| InChI | InChI=1S/C15H24O3Si/c1-15(17)8-10-12-9(14(16)18-10)6-5-7-11(13(12)15)19(2,3)4/h9-10,12,17H,5-8H2,1-4H3/t9-,10+,12+,15-/m0/s1 |
| InChIKey | KYPUEVXJLRPIAQ-MAWWSGROSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|