C22H40O4Si — CID 91271104
(3aR,4R,5R,6aS)-4-(3-hydroxy-3-methyloct-1-enyl)-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 91271104) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-(3-hydroxy-3-methyloct-1-enyl)-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-(3-hydroxy-3-methyloct-1-enyl)-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 91271104 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-(3-hydroxy-3-methyloct-1-enyl)-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCCC(C)(O)C=C[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H40O4Si/c1-6-10-11-13-22(5,24)14-12-17-18-15-21(23)25-19(18)16-20(17)26-27(7-2,8-3)9-4/h12,14,17-20,24H,6-11,13,15-16H2,1-5H3/t17-,18-,19+,20-,22?/m1/s1 |
| InChIKey | DFGFNBAGHJOLER-GDFBDPINSA-N |
| XLogP | 5.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|