C15H24N6O3 — CID 50904402
4-N-cyclohexyl-2-N-methyl-6-morpholin-4-yl-5-nitropyrimidine-2,4-diamine (PubChem CID 50904402) has the molecular formula C15H24N6O3 and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N-methyl-6-morpholin-4-yl-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclohexyl-2-N-methyl-6-morpholin-4-yl-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 50904402 |
| Molecular Formula | C15H24N6O3 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 4-N-cyclohexyl-2-N-methyl-6-morpholin-4-yl-5-nitropyrimidine-2,4-diamine |
| SMILES | CNc1nc(NC2CCCCC2)c([N+](=O)[O-])c(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H24N6O3/c1-16-15-18-13(17-11-5-3-2-4-6-11)12(21(22)23)14(19-15)20-7-9-24-10-8-20/h11H,2-10H2,1H3,(H2,16,17,18,19) |
| InChIKey | KAXOLGVISQXNMR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|