C18H26O2 — CID 50905546
[4-(3-methylidenenonan-2-yl)phenyl] acetate (PubChem CID 50905546) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is [4-(3-methylidenenonan-2-yl)phenyl] acetate.
| Compound Name | [4-(3-methylidenenonan-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 50905546 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | [4-(3-methylidenenonan-2-yl)phenyl] acetate |
| SMILES | C=C(CCCCCC)C(C)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C18H26O2/c1-5-6-7-8-9-14(2)15(3)17-10-12-18(13-11-17)20-16(4)19/h10-13,15H,2,5-9H2,1,3-4H3 |
| InChIKey | VWCCDSAWGXGSEI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|