C17H23N3O4 — CID 50906228
ethyl 2,2-dimethyl-1-[[(4-methylbenzoyl)amino]carbamoylamino]cyclopropane-1-carboxylate (PubChem CID 50906228) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-1-[[(4-methylbenzoyl)amino]carbamoylamino]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2,2-dimethyl-1-[[(4-methylbenzoyl)amino]carbamoylamino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 50906228 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethyl 2,2-dimethyl-1-[[(4-methylbenzoyl)amino]carbamoylamino]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)NNC(=O)c2ccc(C)cc2)CC1(C)C |
| InChI | InChI=1S/C17H23N3O4/c1-5-24-14(22)17(10-16(17,3)4)18-15(23)20-19-13(21)12-8-6-11(2)7-9-12/h6-9H,5,10H2,1-4H3,(H,19,21)(H2,18,20,23) |
| InChIKey | BOLXPTJSWNBMLK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|