C19H15N5O3S — CID 50906253
3-(4-methoxyphenyl)-2-[(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)amino]quinazolin-4-one (PubChem CID 50906253) has the molecular formula C19H15N5O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-[(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)amino]quinazolin-4-one.
| Compound Name | 3-(4-methoxyphenyl)-2-[(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)amino]quinazolin-4-one |
|---|---|
| PubChem CID | 50906253 |
| Molecular Formula | C19H15N5O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-[(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)amino]quinazolin-4-one |
| SMILES | COc1ccc(-n2c(Nc3cc(=O)[nH]c(=S)[nH]3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C19H15N5O3S/c1-27-12-8-6-11(7-9-12)24-17(26)13-4-2-3-5-14(13)20-18(24)21-15-10-16(25)23-19(28)22-15/h2-10H,1H3,(H3,20,21,22,23,25,28) |
| InChIKey | IEAIRGASPHJJTG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|