C14H13N5O2S — CID 50906046
3-ethyl-2-[(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)amino]quinazolin-4-one (PubChem CID 50906046) has the molecular formula C14H13N5O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is 3-ethyl-2-[(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)amino]quinazolin-4-one.
| Compound Name | 3-ethyl-2-[(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)amino]quinazolin-4-one |
|---|---|
| PubChem CID | 50906046 |
| Molecular Formula | C14H13N5O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-ethyl-2-[(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)amino]quinazolin-4-one |
| SMILES | CCn1c(Nc2cc(=O)[nH]c(=S)[nH]2)nc2ccccc2c1=O |
| InChI | InChI=1S/C14H13N5O2S/c1-2-19-12(21)8-5-3-4-6-9(8)15-13(19)16-10-7-11(20)18-14(22)17-10/h3-7H,2H2,1H3,(H3,15,16,17,18,20,22) |
| InChIKey | SBJNMUWXYDOBHS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|