C30H38N2O4S2 — CID 50907400
5-(3,3-dimethylbut-1-ynyl)-3-[[4-(1-hydroxypyridin-1-ium-2-yl)sulfanylcyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate (PubChem CID 50907400) has the molecular formula C30H38N2O4S2 and a molecular weight of 554.78 g/mol. Its IUPAC name is 5-(3,3-dimethylbut-1-ynyl)-3-[[4-(1-hydroxypyridin-1-ium-2-yl)sulfanylcyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate.
| Compound Name | 5-(3,3-dimethylbut-1-ynyl)-3-[[4-(1-hydroxypyridin-1-ium-2-yl)sulfanylcyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 50907400 |
| Molecular Formula | C30H38N2O4S2 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 5-(3,3-dimethylbut-1-ynyl)-3-[[4-(1-hydroxypyridin-1-ium-2-yl)sulfanylcyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate |
| SMILES | CC1CCC(C(=O)N(c2cc(C#CC(C)(C)C)sc2C(=O)[O-])C2CCC(Sc3cccc[n+]3O)CC2)CC1 |
| InChI | InChI=1S/C30H38N2O4S2/c1-20-8-10-21(11-9-20)28(33)32(25-19-24(16-17-30(2,3)4)38-27(25)29(34)35)22-12-14-23(15-13-22)37-26-7-5-6-18-31(26)36/h5-7,18-23H,8-15H2,1-4H3,(H-,34,35,36) |
| InChIKey | MYIGNPZJOXMBGJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|