C20H13ClN2O4S — CID 50907932
4-[1-(4-chlorobenzoyl)benzimidazol-2-yl]benzenesulfonic acid (PubChem CID 50907932) has the molecular formula C20H13ClN2O4S and a molecular weight of 412.85 g/mol. Its IUPAC name is 4-[1-(4-chlorobenzoyl)benzimidazol-2-yl]benzenesulfonic acid.
| Compound Name | 4-[1-(4-chlorobenzoyl)benzimidazol-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 50907932 |
| Molecular Formula | C20H13ClN2O4S |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 4-[1-(4-chlorobenzoyl)benzimidazol-2-yl]benzenesulfonic acid |
| SMILES | O=C(c1ccc(Cl)cc1)n1c(-c2ccc(S(=O)(=O)O)cc2)nc2ccccc21 |
| InChI | InChI=1S/C20H13ClN2O4S/c21-15-9-5-14(6-10-15)20(24)23-18-4-2-1-3-17(18)22-19(23)13-7-11-16(12-8-13)28(25,26)27/h1-12H,(H,25,26,27) |
| InChIKey | WITXMTRAGFTXNC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|