C17H17N3O3 — CID 50908752
4-[1-[(2,3-dimethoxyphenyl)methyl]triazol-4-yl]phenol (PubChem CID 50908752) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 4-[1-[(2,3-dimethoxyphenyl)methyl]triazol-4-yl]phenol.
| Compound Name | 4-[1-[(2,3-dimethoxyphenyl)methyl]triazol-4-yl]phenol |
|---|---|
| PubChem CID | 50908752 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-[1-[(2,3-dimethoxyphenyl)methyl]triazol-4-yl]phenol |
| SMILES | COc1cccc(Cn2cc(-c3ccc(O)cc3)nn2)c1OC |
| InChI | InChI=1S/C17H17N3O3/c1-22-16-5-3-4-13(17(16)23-2)10-20-11-15(18-19-20)12-6-8-14(21)9-7-12/h3-9,11,21H,10H2,1-2H3 |
| InChIKey | IAZNDXVEAROTIW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |