About 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium
2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium (PubChem CID 50909589) has the molecular formula C4H13Cl2N4Ru-3
and a molecular weight of 289.15 g/mol. Its IUPAC name is 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium.
Molecular Properties
| Compound Name | 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium |
| PubChem CID | 50909589 |
| Molecular Formula | C4H13Cl2N4Ru-3 |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium |
| SMILES | Cl[Ru]Cl.[NH-]CCN.[NH-]CC[NH-] |
| InChI | InChI=1S/C2H7N2.C2H6N2.2ClH.Ru/c2*3-1-2-4;;;/h3H,1-2,4H2;3-4H,1-2H2;2*1H;/q-1;-2;;;+2/p-2 |
| InChIKey | UNVYJDLVCVSFPN-UHFFFAOYSA-L |
| XLogP | 2.46 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium?
The IUPAC name of 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium (CID 50909589) is 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium.
What is the SMILES notation for 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium?
The canonical SMILES for 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium is Cl[Ru]Cl.[NH-]CCN.[NH-]CC[NH-].
What is the InChIKey of 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium?
The InChIKey is UNVYJDLVCVSFPN-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H7N2.C2H6N2.2ClH.Ru/c2*3-1-2-4;;;/h3H,1-2,4H2;3-4H,1-2H2;2*1H;/q-1;-2;;;+2/p-2.
What are the key properties of 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium?
2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium has a molecular weight of 289.15 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethylazanide;2-azanidylethylazanide;dichlororuthenium is sourced from PubChem (CID 50909589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).