About Solavetivol
Solavetivol (PubChem CID 50909827) has the molecular formula C15H24O
and a molecular weight of 220.35 g/mol. Its IUPAC name is (3R,5S,6R,8S)-6,10-dimethyl-3-prop-1-en-2-ylspiro[4.5]dec-9-en-8-ol.
Molecular Properties
| Compound Name | Solavetivol |
| PubChem CID | 50909827 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (3R,5S,6R,8S)-6,10-dimethyl-3-prop-1-en-2-ylspiro[4.5]dec-9-en-8-ol |
| SMILES | C[C@@H]1C[C@@H](C=C([C@]12CC[C@H](C2)C(=C)C)C)O |
| InChI | InChI=1S/C15H24O/c1-10(2)13-5-6-15(9-13)11(3)7-14(16)8-12(15)4/h7,12-14,16H,1,5-6,8-9H2,2-4H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | QRPWLSKPROEDAH-KBUPBQIOSA-N |
| XLogP | 4.10 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | 328 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Solavetivol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Solavetivol?
The IUPAC name of Solavetivol (CID 50909827) is (3R,5S,6R,8S)-6,10-dimethyl-3-prop-1-en-2-ylspiro[4.5]dec-9-en-8-ol.
What is the SMILES notation for Solavetivol?
The canonical SMILES for Solavetivol is C[C@@H]1C[C@@H](C=C([C@]12CC[C@H](C2)C(=C)C)C)O.
What is the InChIKey of Solavetivol?
The InChIKey is QRPWLSKPROEDAH-KBUPBQIOSA-N. The full InChI is InChI=1S/C15H24O/c1-10(2)13-5-6-15(9-13)11(3)7-14(16)8-12(15)4/h7,12-14,16H,1,5-6,8-9H2,2-4H3/t12-,13-,14-,15-/m1/s1.
What are the key properties of Solavetivol?
Solavetivol has a molecular weight of 220.35 g/mol, XLogP of 4.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Solavetivol is sourced from PubChem (CID 50909827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).