C14H16N2OS — CID 50910518
(E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(4-methylphenyl)but-2-enamide (PubChem CID 50910518) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is (E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(4-methylphenyl)but-2-enamide.
| Compound Name | (E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(4-methylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 50910518 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(4-methylphenyl)but-2-enamide |
| SMILES | C/C(=C\C(=O)NC1=NCCS1)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16N2OS/c1-10-3-5-12(6-4-10)11(2)9-13(17)16-14-15-7-8-18-14/h3-6,9H,7-8H2,1-2H3,(H,15,16,17)/b11-9+ |
| InChIKey | XMQRGAOHTNLECJ-PKNBQFBNSA-N |
| XLogP | 2.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|