About [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+)
[2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+) (PubChem CID 50911654) has the molecular formula C14H13ClCoN2O2+2
and a molecular weight of 335.66 g/mol. Its IUPAC name is [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+).
Molecular Properties
| Compound Name | [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+) |
| PubChem CID | 50911654 |
| Molecular Formula | C14H13ClCoN2O2+2 |
| Molecular Weight | 335.66 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+) |
| SMILES | Cl[Co+].O=C(NN=Cc1ccccc1[OH2+])c1ccccc1 |
| InChI | InChI=1S/C14H12N2O2.ClH.Co/c17-13-9-5-4-8-12(13)10-15-16-14(18)11-6-2-1-3-7-11;;/h1-10,17H,(H,16,18);1H;/q;;+2 |
| InChIKey | QSQXVQLADLFUIT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.66 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+)?
The IUPAC name of [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+) (CID 50911654) is [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+).
What is the SMILES notation for [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+)?
The canonical SMILES for [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+) is Cl[Co+].O=C(NN=Cc1ccccc1[OH2+])c1ccccc1.
What is the InChIKey of [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+)?
The InChIKey is QSQXVQLADLFUIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2.ClH.Co/c17-13-9-5-4-8-12(13)10-15-16-14(18)11-6-2-1-3-7-11;;/h1-10,17H,(H,16,18);1H;/q;;+2.
What are the key properties of [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+)?
[2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+) has a molecular weight of 335.66 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(benzoylhydrazinylidene)methyl]phenyl]oxidanium;chlorocobalt(1+) is sourced from PubChem (CID 50911654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).