C10H7F5N2O — CID 6900311
N-[(E)-2,2,3,3,3-pentafluoropropylideneamino]benzamide (PubChem CID 6900311) has the molecular formula C10H7F5N2O and a molecular weight of 266.17 g/mol. Its IUPAC name is N-[(E)-2,2,3,3,3-pentafluoropropylideneamino]benzamide.
| Compound Name | N-[(E)-2,2,3,3,3-pentafluoropropylideneamino]benzamide |
|---|---|
| PubChem CID | 6900311 |
| Molecular Formula | C10H7F5N2O |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | N-[(E)-2,2,3,3,3-pentafluoropropylideneamino]benzamide |
| SMILES | O=C(N/N=C/C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H7F5N2O/c11-9(12,10(13,14)15)6-16-17-8(18)7-4-2-1-3-5-7/h1-6H,(H,17,18)/b16-6+ |
| InChIKey | QCYPPGMCVZDNHO-OMCISZLKSA-N |
| XLogP | 2.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|