C38H45F5O4S — CID 50915302
10-[4-[(2S,3R)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-2-yl]phenyl]-2-(5,5,6,6,6-pentafluorohexyl)decanoic acid (PubChem CID 50915302) has the molecular formula C38H45F5O4S and a molecular weight of 692.83 g/mol. Its IUPAC name is 10-[4-[(2S,3R)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-2-yl]phenyl]-2-(5,5,6,6,6-pentafluorohexyl)decanoic acid.
| Compound Name | 10-[4-[(2S,3R)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-2-yl]phenyl]-2-(5,5,6,6,6-pentafluorohexyl)decanoic acid |
|---|---|
| PubChem CID | 50915302 |
| Molecular Formula | C38H45F5O4S |
| Molecular Weight | 692.83 g/mol |
| Exact Mass | 692.30 |
| IUPAC Name | 10-[4-[(2S,3R)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-2-yl]phenyl]-2-(5,5,6,6,6-pentafluorohexyl)decanoic acid |
| SMILES | C[C@]1(c2ccc(O)cc2)Cc2ccc(O)cc2S[C@H]1c1ccc(CCCCCCCCC(CCCCC(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C38H45F5O4S/c1-36(30-18-21-31(44)22-19-30)25-29-17-20-32(45)24-33(29)48-34(36)27-15-13-26(14-16-27)10-6-4-2-3-5-7-11-28(35(46)47)12-8-9-23-37(39,40)38(41,42)43/h13-22,24,28,34,44-45H,2-12,23,25H2,1H3,(H,46,47)/t28?,34-,36+/m0/s1 |
| InChIKey | IHTVHYNPIISXKE-PKRBPSIHSA-N |
| XLogP | 11.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.83 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|