C23H28N2 — CID 50915818
N,N-dimethyl-1-[1-(3-methylbut-2-enyl)-5-(3-methylphenyl)indol-3-yl]methanamine (PubChem CID 50915818) has the molecular formula C23H28N2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N,N-dimethyl-1-[1-(3-methylbut-2-enyl)-5-(3-methylphenyl)indol-3-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[1-(3-methylbut-2-enyl)-5-(3-methylphenyl)indol-3-yl]methanamine |
|---|---|
| PubChem CID | 50915818 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | N,N-dimethyl-1-[1-(3-methylbut-2-enyl)-5-(3-methylphenyl)indol-3-yl]methanamine |
| SMILES | CC(C)=CCn1cc(CN(C)C)c2cc(-c3cccc(C)c3)ccc21 |
| InChI | InChI=1S/C23H28N2/c1-17(2)11-12-25-16-21(15-24(4)5)22-14-20(9-10-23(22)25)19-8-6-7-18(3)13-19/h6-11,13-14,16H,12,15H2,1-5H3 |
| InChIKey | ZZUOQXSOWCZPNI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|