C17H17BrF2N4O3 — CID 50916175
4-(2-bromo-4,5-difluorophenoxy)-N-(2-methyl-3-oxopyridazin-4-yl)piperidine-1-carboxamide (PubChem CID 50916175) has the molecular formula C17H17BrF2N4O3 and a molecular weight of 443.25 g/mol. Its IUPAC name is 4-(2-bromo-4,5-difluorophenoxy)-N-(2-methyl-3-oxopyridazin-4-yl)piperidine-1-carboxamide.
| Compound Name | 4-(2-bromo-4,5-difluorophenoxy)-N-(2-methyl-3-oxopyridazin-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 50916175 |
| Molecular Formula | C17H17BrF2N4O3 |
| Molecular Weight | 443.25 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 4-(2-bromo-4,5-difluorophenoxy)-N-(2-methyl-3-oxopyridazin-4-yl)piperidine-1-carboxamide |
| SMILES | Cn1nccc(NC(=O)N2CCC(Oc3cc(F)c(F)cc3Br)CC2)c1=O |
| InChI | InChI=1S/C17H17BrF2N4O3/c1-23-16(25)14(2-5-21-23)22-17(26)24-6-3-10(4-7-24)27-15-9-13(20)12(19)8-11(15)18/h2,5,8-10H,3-4,6-7H2,1H3,(H,22,26) |
| InChIKey | MHAPGUZEWFWMMW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|