C25H36N2O3 — CID 50917124
benzyl (2R)-2-[[(4aR,5S,7R,8aR)-1,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-5-yl]methyl]-4-oxopiperidine-1-carboxylate (PubChem CID 50917124) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is benzyl (2R)-2-[[(4aR,5S,7R,8aR)-1,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-5-yl]methyl]-4-oxopiperidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[[(4aR,5S,7R,8aR)-1,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-5-yl]methyl]-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 50917124 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | benzyl (2R)-2-[[(4aR,5S,7R,8aR)-1,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-5-yl]methyl]-4-oxopiperidine-1-carboxylate |
| SMILES | C[C@@H]1C[C@@H](C[C@@H]2CC(=O)CCN2C(=O)OCc2ccccc2)[C@H]2CCCN(C)[C@@H]2C1 |
| InChI | InChI=1S/C25H36N2O3/c1-18-13-20(23-9-6-11-26(2)24(23)14-18)15-21-16-22(28)10-12-27(21)25(29)30-17-19-7-4-3-5-8-19/h3-5,7-8,18,20-21,23-24H,6,9-17H2,1-2H3/t18-,20+,21-,23-,24-/m1/s1 |
| InChIKey | PUTZPTLVSGIMCD-QXGNVZEXSA-N |
| XLogP | 4.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |