C22H25NO3 — CID 156889648
benzyl 4-oxo-2-(2-propan-2-ylphenyl)piperidine-1-carboxylate (PubChem CID 156889648) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is benzyl 4-oxo-2-(2-propan-2-ylphenyl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-oxo-2-(2-propan-2-ylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156889648 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | benzyl 4-oxo-2-(2-propan-2-ylphenyl)piperidine-1-carboxylate |
| SMILES | CC(C)c1ccccc1C1CC(=O)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H25NO3/c1-16(2)19-10-6-7-11-20(19)21-14-18(24)12-13-23(21)22(25)26-15-17-8-4-3-5-9-17/h3-11,16,21H,12-15H2,1-2H3 |
| InChIKey | FPHGWFYUXMBTSS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |