C23H21NO3 — CID 46704336
benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate (PubChem CID 46704336) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate.
| Compound Name | benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 46704336 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate |
| SMILES | O=C1CCN(C(=O)OCc2ccccc2)C(c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C23H21NO3/c25-21-12-13-24(23(26)27-16-17-6-2-1-3-7-17)22(15-21)20-11-10-18-8-4-5-9-19(18)14-20/h1-11,14,22H,12-13,15-16H2 |
| InChIKey | MOHGJILAUUMRBB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |