benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate

C23H21NO3 — CID 46704336

IUPACbenzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate
SMILESO=C1CCN(C(=O)OCc2ccccc2)C(c2ccc3ccccc3c2)C1
InChIInChI=1S/C23H21NO3/c25-21-12-13-24(23(26)27-16-17-6-2-1-3-7-17)22(15-21)20-11-10-18-8-4-5-9-19(18)14-20/h1-11,14,22H,12-13,15-16H2
InChIKeyMOHGJILAUUMRBB-UHFFFAOYSA-N
MW359.43 g/mol
LogP4.88
Rot. Bonds3

About benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate

benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate (PubChem CID 46704336) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate.

Molecular Properties

Compound Namebenzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate
PubChem CID46704336
Molecular FormulaC23H21NO3
Molecular Weight359.43 g/mol
Exact Mass359.15
IUPAC Namebenzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate
SMILESO=C1CCN(C(=O)OCc2ccccc2)C(c2ccc3ccccc3c2)C1
InChIInChI=1S/C23H21NO3/c25-21-12-13-24(23(26)27-16-17-6-2-1-3-7-17)22(15-21)20-11-10-18-8-4-5-9-19(18)14-20/h1-11,14,22H,12-13,15-16H2
InChIKeyMOHGJILAUUMRBB-UHFFFAOYSA-N
XLogP4.88
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500359.43
LogP ≤ 54.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate?
The IUPAC name of benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate (CID 46704336) is benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate.
What is the SMILES notation for benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate?
The canonical SMILES for benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate is O=C1CCN(C(=O)OCc2ccccc2)C(c2ccc3ccccc3c2)C1.
What is the InChIKey of benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate?
The InChIKey is MOHGJILAUUMRBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO3/c25-21-12-13-24(23(26)27-16-17-6-2-1-3-7-17)22(15-21)20-11-10-18-8-4-5-9-19(18)14-20/h1-11,14,22H,12-13,15-16H2.
What are the key properties of benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate?
benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate has a molecular weight of 359.43 g/mol, XLogP of 4.88, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-naphthalen-2-yl-4-oxopiperidine-1-carboxylate is sourced from PubChem (CID 46704336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).