C18H24N6O2S2 — CID 5091817
N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide (PubChem CID 5091817) has the molecular formula C18H24N6O2S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 5091817 |
| Molecular Formula | C18H24N6O2S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=S)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H24N6O2S2/c1-14-5-6-15(28(25,26)22(2)3)13-16(14)21-18(27)24-11-9-23(10-12-24)17-19-7-4-8-20-17/h4-8,13H,9-12H2,1-3H3,(H,21,27) |
| InChIKey | YUEFXZGFPPVINP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|