C22H29ClN4O2S2 — CID 3907981
4-(3-chlorophenyl)-N-[5-(diethylsulfamoyl)-2-methylphenyl]piperazine-1-carbothioamide (PubChem CID 3907981) has the molecular formula C22H29ClN4O2S2 and a molecular weight of 481.09 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-[5-(diethylsulfamoyl)-2-methylphenyl]piperazine-1-carbothioamide.
| Compound Name | 4-(3-chlorophenyl)-N-[5-(diethylsulfamoyl)-2-methylphenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3907981 |
| Molecular Formula | C22H29ClN4O2S2 |
| Molecular Weight | 481.09 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 4-(3-chlorophenyl)-N-[5-(diethylsulfamoyl)-2-methylphenyl]piperazine-1-carbothioamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(NC(=S)N2CCN(c3cccc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C22H29ClN4O2S2/c1-4-27(5-2)31(28,29)20-10-9-17(3)21(16-20)24-22(30)26-13-11-25(12-14-26)19-8-6-7-18(23)15-19/h6-10,15-16H,4-5,11-14H2,1-3H3,(H,24,30) |
| InChIKey | IXLCUHWCSMUYPF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.09 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|