C10H5Br2Cl2NO2S2 — CID 5092209
4-bromo-N-(3-bromophenyl)-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 5092209) has the molecular formula C10H5Br2Cl2NO2S2 and a molecular weight of 466.00 g/mol. Its IUPAC name is 4-bromo-N-(3-bromophenyl)-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | 4-bromo-N-(3-bromophenyl)-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 5092209 |
| Molecular Formula | C10H5Br2Cl2NO2S2 |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 462.75 |
| IUPAC Name | 4-bromo-N-(3-bromophenyl)-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Br)c1)c1c(Cl)sc(Cl)c1Br |
| InChI | InChI=1S/C10H5Br2Cl2NO2S2/c11-5-2-1-3-6(4-5)15-19(16,17)8-7(12)9(13)18-10(8)14/h1-4,15H |
| InChIKey | HJTPJQPBQHNENC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |