C12H10BrCl2NO4S2 — CID 3777525
4-bromo-2,5-dichloro-N-(3,5-dimethoxyphenyl)thiophene-3-sulfonamide (PubChem CID 3777525) has the molecular formula C12H10BrCl2NO4S2 and a molecular weight of 447.16 g/mol. Its IUPAC name is 4-bromo-2,5-dichloro-N-(3,5-dimethoxyphenyl)thiophene-3-sulfonamide.
| Compound Name | 4-bromo-2,5-dichloro-N-(3,5-dimethoxyphenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 3777525 |
| Molecular Formula | C12H10BrCl2NO4S2 |
| Molecular Weight | 447.16 g/mol |
| Exact Mass | 444.86 |
| IUPAC Name | 4-bromo-2,5-dichloro-N-(3,5-dimethoxyphenyl)thiophene-3-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2c(Cl)sc(Cl)c2Br)cc(OC)c1 |
| InChI | InChI=1S/C12H10BrCl2NO4S2/c1-19-7-3-6(4-8(5-7)20-2)16-22(17,18)10-9(13)11(14)21-12(10)15/h3-5,16H,1-2H3 |
| InChIKey | YCMKLIKNJVSXRK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.16 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |