About (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane
(2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane (PubChem CID 50924334) has the molecular formula C13H28OSi
and a molecular weight of 228.45 g/mol. Its IUPAC name is (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane.
Molecular Properties
| Compound Name | (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane |
| PubChem CID | 50924334 |
| Molecular Formula | C13H28OSi |
| Molecular Weight | 228.45 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane |
| SMILES | CC(C)(C)C(=CO[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H28OSi/c1-12(2,3)11(13(4,5)6)10-14-15(7,8)9/h10H,1-9H3 |
| InChIKey | FJLSIJSTVIKECW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane?
The IUPAC name of (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane (CID 50924334) is (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane.
What is the SMILES notation for (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane?
The canonical SMILES for (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane is CC(C)(C)C(=CO[Si](C)(C)C)C(C)(C)C.
What is the InChIKey of (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane?
The InChIKey is FJLSIJSTVIKECW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28OSi/c1-12(2,3)11(13(4,5)6)10-14-15(7,8)9/h10H,1-9H3.
What are the key properties of (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane?
(2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane has a molecular weight of 228.45 g/mol, XLogP of 4.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-3,3-dimethylbut-1-enoxy)-trimethylsilane is sourced from PubChem (CID 50924334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).