About (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane
(2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane (PubChem CID 150237464) has the molecular formula C12H26OSi
and a molecular weight of 214.42 g/mol. Its IUPAC name is (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane.
Molecular Properties
| Compound Name | (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane |
| PubChem CID | 150237464 |
| Molecular Formula | C12H26OSi |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane |
| SMILES | CCO[SiH2]C=C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H26OSi/c1-8-13-14-9-10(11(2,3)4)12(5,6)7/h9H,8,14H2,1-7H3 |
| InChIKey | FWUVPHUPCUYDPG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane?
The IUPAC name of (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane (CID 150237464) is (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane.
What is the SMILES notation for (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane?
The canonical SMILES for (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane is CCO[SiH2]C=C(C(C)(C)C)C(C)(C)C.
What is the InChIKey of (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane?
The InChIKey is FWUVPHUPCUYDPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26OSi/c1-8-13-14-9-10(11(2,3)4)12(5,6)7/h9H,8,14H2,1-7H3.
What are the key properties of (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane?
(2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane has a molecular weight of 214.42 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-3,3-dimethylbut-1-enyl)-ethoxysilane is sourced from PubChem (CID 150237464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).