C23H18N6O — CID 50924471
[2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]-3H-benzimidazol-5-yl]-phenylmethanone (PubChem CID 50924471) has the molecular formula C23H18N6O and a molecular weight of 394.44 g/mol. Its IUPAC name is [2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]-3H-benzimidazol-5-yl]-phenylmethanone.
| Compound Name | [2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]-3H-benzimidazol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 50924471 |
| Molecular Formula | C23H18N6O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]-3H-benzimidazol-5-yl]-phenylmethanone |
| SMILES | Cn1cc(-c2cnc(N)c(-c3nc4ccc(C(=O)c5ccccc5)cc4[nH]3)c2)cn1 |
| InChI | InChI=1S/C23H18N6O/c1-29-13-17(12-26-29)16-9-18(22(24)25-11-16)23-27-19-8-7-15(10-20(19)28-23)21(30)14-5-3-2-4-6-14/h2-13H,1H3,(H2,24,25)(H,27,28) |
| InChIKey | NOLOLEFYIBQABJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |