4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid

C36H26N2O2 — CID 50925638

IUPAC4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid
SMILESO=C(O)c1ccc(C(c2c(-c3ccccc3)[nH]c3ccccc23)c2c(-c3ccccc3)[nH]c3ccccc23)cc1
InChIInChI=1S/C36H26N2O2/c39-36(40)26-21-19-23(20-22-26)31(32-27-15-7-9-17-29(27)37-34(32)24-11-3-1-4-12-24)33-28-16-8-10-18-30(28)38-35(33)25-13-5-2-6-14-25/h1-22,31,37-38H,(H,39,40)
InChIKeyCLFJUOVLIFWCAE-UHFFFAOYSA-N
MW518.62 g/mol
LogP8.86
Rot. Bonds6

About 4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid

4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid (PubChem CID 50925638) has the molecular formula C36H26N2O2 and a molecular weight of 518.62 g/mol. Its IUPAC name is 4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid.

Molecular Properties

Compound Name4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid
PubChem CID50925638
Molecular FormulaC36H26N2O2
Molecular Weight518.62 g/mol
Exact Mass518.20
IUPAC Name4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid
SMILESO=C(O)c1ccc(C(c2c(-c3ccccc3)[nH]c3ccccc23)c2c(-c3ccccc3)[nH]c3ccccc23)cc1
InChIInChI=1S/C36H26N2O2/c39-36(40)26-21-19-23(20-22-26)31(32-27-15-7-9-17-29(27)37-34(32)24-11-3-1-4-12-24)33-28-16-8-10-18-30(28)38-35(33)25-13-5-2-6-14-25/h1-22,31,37-38H,(H,39,40)
InChIKeyCLFJUOVLIFWCAE-UHFFFAOYSA-N
XLogP8.86
TPSA68.88 Ų
H-Bond Donors3
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms40
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500518.62
LogP ≤ 58.86
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 101

Analyze 4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid?
The IUPAC name of 4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid (CID 50925638) is 4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid.
What is the SMILES notation for 4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid?
The canonical SMILES for 4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid is O=C(O)c1ccc(C(c2c(-c3ccccc3)[nH]c3ccccc23)c2c(-c3ccccc3)[nH]c3ccccc23)cc1.
What is the InChIKey of 4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid?
The InChIKey is CLFJUOVLIFWCAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H26N2O2/c39-36(40)26-21-19-23(20-22-26)31(32-27-15-7-9-17-29(27)37-34(32)24-11-3-1-4-12-24)33-28-16-8-10-18-30(28)38-35(33)25-13-5-2-6-14-25/h1-22,31,37-38H,(H,39,40).
What are the key properties of 4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid?
4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid has a molecular weight of 518.62 g/mol, XLogP of 8.86, 6 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis(2-phenyl-1H-indol-3-yl)methyl]benzoic acid is sourced from PubChem (CID 50925638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).