C22H15N3O2S — CID 5092910
12-oxo-N-(thiophen-2-ylmethyl)-12H-benzo[g]pyrido[2,1-b]quinazoline-4-carboxamide (PubChem CID 5092910) has the molecular formula C22H15N3O2S and a molecular weight of 385.45 g/mol. Its IUPAC name is 12-oxo-N-(thiophen-2-ylmethyl)-12H-benzo[g]pyrido[2,1-b]quinazoline-4-carboxamide.
| Compound Name | 12-oxo-N-(thiophen-2-ylmethyl)-12H-benzo[g]pyrido[2,1-b]quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 5092910 |
| Molecular Formula | C22H15N3O2S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 12-oxo-N-(thiophen-2-ylmethyl)-12H-benzo[g]pyrido[2,1-b]quinazoline-4-carboxamide |
| SMILES | O=C(NCc1cccs1)c1cccn2c(=O)c3cc4ccccc4cc3nc12 |
| InChI | InChI=1S/C22H15N3O2S/c26-21(23-13-16-7-4-10-28-16)17-8-3-9-25-20(17)24-19-12-15-6-2-1-5-14(15)11-18(19)22(25)27/h1-12H,13H2,(H,23,26) |
| InChIKey | WIOCTDAZVPOBMC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|