C20H18F2N4O6 — CID 162763912
N-[2-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]ethyl]-14,14-difluoro-9-oxo-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene-4-carboxamide (PubChem CID 162763912) has the molecular formula C20H18F2N4O6 and a molecular weight of 448.38 g/mol. Its IUPAC name is N-[2-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]ethyl]-14,14-difluoro-9-oxo-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene-4-carboxamide.
| Compound Name | N-[2-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]ethyl]-14,14-difluoro-9-oxo-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 162763912 |
| Molecular Formula | C20H18F2N4O6 |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-[2-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]ethyl]-14,14-difluoro-9-oxo-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene-4-carboxamide |
| SMILES | O=C(NCCN1C[C@@H](O)[C@H](O)C1)c1cccn2c(=O)c3cc4c(cc3nc12)OC(F)(F)O4 |
| InChI | InChI=1S/C20H18F2N4O6/c21-20(22)31-15-6-11-12(7-16(15)32-20)24-17-10(2-1-4-26(17)19(11)30)18(29)23-3-5-25-8-13(27)14(28)9-25/h1-2,4,6-7,13-14,27-28H,3,5,8-9H2,(H,23,29)/t13-,14-/m1/s1 |
| InChIKey | ZQUVPBDNMXSNJV-ZIAGYGMSSA-N |
| XLogP | -0.06 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|