C21H20F2N4O5 — CID 162763917
14,14-difluoro-N-[2-(4-hydroxypiperidin-1-yl)ethyl]-9-oxo-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene-4-carboxamide (PubChem CID 162763917) has the molecular formula C21H20F2N4O5 and a molecular weight of 446.41 g/mol. Its IUPAC name is 14,14-difluoro-N-[2-(4-hydroxypiperidin-1-yl)ethyl]-9-oxo-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene-4-carboxamide.
| Compound Name | 14,14-difluoro-N-[2-(4-hydroxypiperidin-1-yl)ethyl]-9-oxo-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 162763917 |
| Molecular Formula | C21H20F2N4O5 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 14,14-difluoro-N-[2-(4-hydroxypiperidin-1-yl)ethyl]-9-oxo-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaene-4-carboxamide |
| SMILES | O=C(NCCN1CCC(O)CC1)c1cccn2c(=O)c3cc4c(cc3nc12)OC(F)(F)O4 |
| InChI | InChI=1S/C21H20F2N4O5/c22-21(23)31-16-10-14-15(11-17(16)32-21)25-18-13(2-1-6-27(18)20(14)30)19(29)24-5-9-26-7-3-12(28)4-8-26/h1-2,6,10-12,28H,3-5,7-9H2,(H,24,29) |
| InChIKey | UAFZXAAJMOELHG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|