C25H23BrN4O2 — CID 22589998
N-(1-benzylpiperidin-4-yl)-2-bromo-11-oxopyrido[2,1-b]quinazoline-6-carboxamide (PubChem CID 22589998) has the molecular formula C25H23BrN4O2 and a molecular weight of 491.39 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-bromo-11-oxopyrido[2,1-b]quinazoline-6-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-bromo-11-oxopyrido[2,1-b]quinazoline-6-carboxamide |
|---|---|
| PubChem CID | 22589998 |
| Molecular Formula | C25H23BrN4O2 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-bromo-11-oxopyrido[2,1-b]quinazoline-6-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1cccn2c(=O)c3cc(Br)ccc3nc12 |
| InChI | InChI=1S/C25H23BrN4O2/c26-18-8-9-22-21(15-18)25(32)30-12-4-7-20(23(30)28-22)24(31)27-19-10-13-29(14-11-19)16-17-5-2-1-3-6-17/h1-9,12,15,19H,10-11,13-14,16H2,(H,27,31) |
| InChIKey | NFCZBPYXPOKVJT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|