C21H19NO5 — CID 5093002
2-(3,5-dimethoxyphenyl)-4-[3-(2-methoxyphenyl)prop-2-enylidene]-1,3-oxazol-5-one (PubChem CID 5093002) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-4-[3-(2-methoxyphenyl)prop-2-enylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(3,5-dimethoxyphenyl)-4-[3-(2-methoxyphenyl)prop-2-enylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 5093002 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-4-[3-(2-methoxyphenyl)prop-2-enylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(OC)cc(C2=NC(=CC=Cc3ccccc3OC)C(=O)O2)c1 |
| InChI | InChI=1S/C21H19NO5/c1-24-16-11-15(12-17(13-16)25-2)20-22-18(21(23)27-20)9-6-8-14-7-4-5-10-19(14)26-3/h4-13H,1-3H3 |
| InChIKey | DECPCPUUVBUQIE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|