C20H16N4O2 — CID 50936590
(1R,4S,5R)-5-(4-methoxyphenyl)-1-methyl-8-oxobicyclo[2.2.2]octane-2,2,3,3-tetracarbonitrile (PubChem CID 50936590) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is (1R,4S,5R)-5-(4-methoxyphenyl)-1-methyl-8-oxobicyclo[2.2.2]octane-2,2,3,3-tetracarbonitrile.
| Compound Name | (1R,4S,5R)-5-(4-methoxyphenyl)-1-methyl-8-oxobicyclo[2.2.2]octane-2,2,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 50936590 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (1R,4S,5R)-5-(4-methoxyphenyl)-1-methyl-8-oxobicyclo[2.2.2]octane-2,2,3,3-tetracarbonitrile |
| SMILES | COc1ccc([C@@H]2C[C@]3(C)CC(=O)[C@@H]2C(C#N)(C#N)C3(C#N)C#N)cc1 |
| InChI | InChI=1S/C20H16N4O2/c1-18-7-15(13-3-5-14(26-2)6-4-13)17(16(25)8-18)19(9-21,10-22)20(18,11-23)12-24/h3-6,15,17H,7-8H2,1-2H3/t15-,17+,18+/m0/s1 |
| InChIKey | QBQVXYQRBNNTGT-CGTJXYLNSA-N |
| XLogP | 2.84 |
| TPSA | 121.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|