C52H60N2O6 — CID 50937086
2,5-dimethyl-3,6-bis[4-[2-(3,4,5-tripropoxyphenyl)ethynyl]phenyl]pyrazine (PubChem CID 50937086) has the molecular formula C52H60N2O6 and a molecular weight of 809.06 g/mol. Its IUPAC name is 2,5-dimethyl-3,6-bis[4-[2-(3,4,5-tripropoxyphenyl)ethynyl]phenyl]pyrazine.
| Compound Name | 2,5-dimethyl-3,6-bis[4-[2-(3,4,5-tripropoxyphenyl)ethynyl]phenyl]pyrazine |
|---|---|
| PubChem CID | 50937086 |
| Molecular Formula | C52H60N2O6 |
| Molecular Weight | 809.06 g/mol |
| Exact Mass | 808.45 |
| IUPAC Name | 2,5-dimethyl-3,6-bis[4-[2-(3,4,5-tripropoxyphenyl)ethynyl]phenyl]pyrazine |
| SMILES | CCCOc1cc(C#Cc2ccc(-c3nc(C)c(-c4ccc(C#Cc5cc(OCCC)c(OCCC)c(OCCC)c5)cc4)nc3C)cc2)cc(OCCC)c1OCCC |
| InChI | InChI=1S/C52H60N2O6/c1-9-27-55-45-33-41(34-46(56-28-10-2)51(45)59-31-13-5)17-15-39-19-23-43(24-20-39)49-37(7)54-50(38(8)53-49)44-25-21-40(22-26-44)16-18-42-35-47(57-29-11-3)52(60-32-14-6)48(36-42)58-30-12-4/h19-26,33-36H,9-14,27-32H2,1-8H3 |
| InChIKey | FSUDBOCRCQSZKS-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.06 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|