C17H33N2O2+ — CID 50937702
3-ethoxypropyl-[2-oxo-2-[[(1S,2R,4R)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]azanium (PubChem CID 50937702) has the molecular formula C17H33N2O2+ and a molecular weight of 297.46 g/mol. Its IUPAC name is 3-ethoxypropyl-[2-oxo-2-[[(1S,2R,4R)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]azanium.
| Compound Name | 3-ethoxypropyl-[2-oxo-2-[[(1S,2R,4R)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 50937702 |
| Molecular Formula | C17H33N2O2+ |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | 3-ethoxypropyl-[2-oxo-2-[[(1S,2R,4R)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]azanium |
| SMILES | CCOCCC[NH2+]CC(=O)N[C@]1(C)[C@H]2CC[C@H](C2)C1(C)C |
| InChI | InChI=1S/C17H32N2O2/c1-5-21-10-6-9-18-12-15(20)19-17(4)14-8-7-13(11-14)16(17,2)3/h13-14,18H,5-12H2,1-4H3,(H,19,20)/p+1/t13-,14+,17-/m1/s1 |
| InChIKey | ADQOVMUDQNVVLB-JKIFEVAISA-O |
| XLogP | 1.31 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|