C17H33ClN2O2 — CID 6603398
2-(3-ethoxypropylamino)-N-(2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide;hydrochloride (PubChem CID 6603398) has the molecular formula C17H33ClN2O2 and a molecular weight of 332.92 g/mol. Its IUPAC name is 2-(3-ethoxypropylamino)-N-(2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide;hydrochloride.
| Compound Name | 2-(3-ethoxypropylamino)-N-(2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 6603398 |
| Molecular Formula | C17H33ClN2O2 |
| Molecular Weight | 332.92 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-(3-ethoxypropylamino)-N-(2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide;hydrochloride |
| SMILES | CCOCCCNCC(=O)NC1(C)C2CCC(C2)C1(C)C.Cl |
| InChI | InChI=1S/C17H32N2O2.ClH/c1-5-21-10-6-9-18-12-15(20)19-17(4)14-8-7-13(11-14)16(17,2)3;/h13-14,18H,5-12H2,1-4H3,(H,19,20);1H |
| InChIKey | RRKSZTWIIGBERJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.92 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|