C35H31N2O3S+ — CID 50942173
1,3-dibenzyl-4-(furan-2-yl)-5-(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid (PubChem CID 50942173) has the molecular formula C35H31N2O3S+ and a molecular weight of 559.71 g/mol. Its IUPAC name is 1,3-dibenzyl-4-(furan-2-yl)-5-(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid.
| Compound Name | 1,3-dibenzyl-4-(furan-2-yl)-5-(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 50942173 |
| Molecular Formula | C35H31N2O3S+ |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 1,3-dibenzyl-4-(furan-2-yl)-5-(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid |
| SMILES | CSc1ccc(C2(C(=O)O)C(c3ccco3)[N+](Cc3ccccc3)=C(c3ccccc3)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C35H30N2O3S/c1-41-30-21-19-29(20-22-30)35(34(38)39)32(31-18-11-23-40-31)36(24-26-12-5-2-6-13-26)33(28-16-9-4-10-17-28)37(35)25-27-14-7-3-8-15-27/h2-23,32H,24-25H2,1H3/p+1 |
| InChIKey | MYXUWPOTFZROIL-UHFFFAOYSA-O |
| XLogP | 7.20 |
| TPSA | 56.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|