C43H51N3O3 — CID 50942394
2,6-bis[2-(6-ethynyl-4-octoxy-2-pyridinyl)ethynyl]-4-[(2-methylpropan-2-yl)oxy]pyridine (PubChem CID 50942394) has the molecular formula C43H51N3O3 and a molecular weight of 657.90 g/mol. Its IUPAC name is 2,6-bis[2-(6-ethynyl-4-octoxy-2-pyridinyl)ethynyl]-4-[(2-methylpropan-2-yl)oxy]pyridine.
| Compound Name | 2,6-bis[2-(6-ethynyl-4-octoxy-2-pyridinyl)ethynyl]-4-[(2-methylpropan-2-yl)oxy]pyridine |
|---|---|
| PubChem CID | 50942394 |
| Molecular Formula | C43H51N3O3 |
| Molecular Weight | 657.90 g/mol |
| Exact Mass | 657.39 |
| IUPAC Name | 2,6-bis[2-(6-ethynyl-4-octoxy-2-pyridinyl)ethynyl]-4-[(2-methylpropan-2-yl)oxy]pyridine |
| SMILES | C#Cc1cc(OCCCCCCCC)cc(C#Cc2cc(OC(C)(C)C)cc(C#Cc3cc(OCCCCCCCC)cc(C#C)n3)n2)n1 |
| InChI | InChI=1S/C43H51N3O3/c1-8-12-14-16-18-20-26-47-40-28-34(10-3)44-36(30-40)22-24-38-32-42(49-43(5,6)7)33-39(46-38)25-23-37-31-41(29-35(11-4)45-37)48-27-21-19-17-15-13-9-2/h3-4,28-33H,8-9,12-21,26-27H2,1-2,5-7H3 |
| InChIKey | OEGHZRLGFHCTIV-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.90 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|