C23H30Cl2N4O — CID 50943497
3-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 50943497) has the molecular formula C23H30Cl2N4O and a molecular weight of 449.43 g/mol. Its IUPAC name is 3-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 50943497 |
| Molecular Formula | C23H30Cl2N4O |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 3-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1nc2n(c(=O)c1CCCCN1CCN(c3cccc(Cl)c3Cl)CC1)CCCC2 |
| InChI | InChI=1S/C23H30Cl2N4O/c1-17-18(23(30)29-12-5-3-10-21(29)26-17)7-2-4-11-27-13-15-28(16-14-27)20-9-6-8-19(24)22(20)25/h6,8-9H,2-5,7,10-16H2,1H3 |
| InChIKey | KHYOKMTYSIMCIA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|