C20H21ClN2O3 — CID 50945546
N-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)azepane-1-carboxamide (PubChem CID 50945546) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)azepane-1-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 50945546 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)azepane-1-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)N1CCCCCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O3/c21-15-7-5-14(6-8-15)17-4-2-1-3-11-23(17)20(24)22-16-9-10-18-19(12-16)26-13-25-18/h5-10,12,17H,1-4,11,13H2,(H,22,24) |
| InChIKey | SFFNAOKIAWMBCT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |