C17H26N2O3S — CID 50946741
N-(3-methylphenyl)-N-[1-(3-methylpiperidin-1-yl)-1-oxopropan-2-yl]methanesulfonamide (PubChem CID 50946741) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is N-(3-methylphenyl)-N-[1-(3-methylpiperidin-1-yl)-1-oxopropan-2-yl]methanesulfonamide.
| Compound Name | N-(3-methylphenyl)-N-[1-(3-methylpiperidin-1-yl)-1-oxopropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 50946741 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-(3-methylphenyl)-N-[1-(3-methylpiperidin-1-yl)-1-oxopropan-2-yl]methanesulfonamide |
| SMILES | Cc1cccc(N(C(C)C(=O)N2CCCC(C)C2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H26N2O3S/c1-13-7-5-9-16(11-13)19(23(4,21)22)15(3)17(20)18-10-6-8-14(2)12-18/h5,7,9,11,14-15H,6,8,10,12H2,1-4H3 |
| InChIKey | AYMLKODJUICYDE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |