C17H25N3O4S — CID 95119036
1-[(2S)-2-(3-methyl-N-methylsulfonylanilino)propanoyl]piperidine-4-carboxamide (PubChem CID 95119036) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-[(2S)-2-(3-methyl-N-methylsulfonylanilino)propanoyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2S)-2-(3-methyl-N-methylsulfonylanilino)propanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 95119036 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-[(2S)-2-(3-methyl-N-methylsulfonylanilino)propanoyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(N([C@@H](C)C(=O)N2CCC(C(N)=O)CC2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H25N3O4S/c1-12-5-4-6-15(11-12)20(25(3,23)24)13(2)17(22)19-9-7-14(8-10-19)16(18)21/h4-6,11,13-14H,7-10H2,1-3H3,(H2,18,21)/t13-/m0/s1 |
| InChIKey | CBUZACWJBAIVGY-ZDUSSCGKSA-N |
| XLogP | 0.87 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |