C21H26N4S — CID 50947714
4-(4-benzylpiperazin-1-yl)-2,6-diethylthieno[2,3-d]pyrimidine (PubChem CID 50947714) has the molecular formula C21H26N4S and a molecular weight of 366.53 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-2,6-diethylthieno[2,3-d]pyrimidine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-2,6-diethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 50947714 |
| Molecular Formula | C21H26N4S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-2,6-diethylthieno[2,3-d]pyrimidine |
| SMILES | CCc1nc(N2CCN(Cc3ccccc3)CC2)c2cc(CC)sc2n1 |
| InChI | InChI=1S/C21H26N4S/c1-3-17-14-18-20(22-19(4-2)23-21(18)26-17)25-12-10-24(11-13-25)15-16-8-6-5-7-9-16/h5-9,14H,3-4,10-13,15H2,1-2H3 |
| InChIKey | KVFXSPVKDOQPEG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |