C24H24N4S — CID 985301
4-(4-benzylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine (PubChem CID 985301) has the molecular formula C24H24N4S and a molecular weight of 400.55 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 985301 |
| Molecular Formula | C24H24N4S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine |
| SMILES | Cc1nc(N2CCN(Cc3ccccc3)CC2)c2cc(-c3ccccc3)sc2n1 |
| InChI | InChI=1S/C24H24N4S/c1-18-25-23(21-16-22(29-24(21)26-18)20-10-6-3-7-11-20)28-14-12-27(13-15-28)17-19-8-4-2-5-9-19/h2-11,16H,12-15,17H2,1H3 |
| InChIKey | PSURYBSSGRYHMV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |