C19H20N4O4 — CID 50948903
methyl 2-[3-methyl-2-oxo-4-(2-phenylpyrimidine-5-carbonyl)piperazin-1-yl]acetate (PubChem CID 50948903) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is methyl 2-[3-methyl-2-oxo-4-(2-phenylpyrimidine-5-carbonyl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-[3-methyl-2-oxo-4-(2-phenylpyrimidine-5-carbonyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 50948903 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | methyl 2-[3-methyl-2-oxo-4-(2-phenylpyrimidine-5-carbonyl)piperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(C(=O)c2cnc(-c3ccccc3)nc2)C(C)C1=O |
| InChI | InChI=1S/C19H20N4O4/c1-13-18(25)22(12-16(24)27-2)8-9-23(13)19(26)15-10-20-17(21-11-15)14-6-4-3-5-7-14/h3-7,10-11,13H,8-9,12H2,1-2H3 |
| InChIKey | HZQAPLCAZOJWLR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |