C18H18FN3O4 — CID 95127053
methyl 2-[(3S)-4-(8-fluoroquinoline-2-carbonyl)-3-methyl-2-oxopiperazin-1-yl]acetate (PubChem CID 95127053) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is methyl 2-[(3S)-4-(8-fluoroquinoline-2-carbonyl)-3-methyl-2-oxopiperazin-1-yl]acetate.
| Compound Name | methyl 2-[(3S)-4-(8-fluoroquinoline-2-carbonyl)-3-methyl-2-oxopiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 95127053 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | methyl 2-[(3S)-4-(8-fluoroquinoline-2-carbonyl)-3-methyl-2-oxopiperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(C(=O)c2ccc3cccc(F)c3n2)[C@@H](C)C1=O |
| InChI | InChI=1S/C18H18FN3O4/c1-11-17(24)21(10-15(23)26-2)8-9-22(11)18(25)14-7-6-12-4-3-5-13(19)16(12)20-14/h3-7,11H,8-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | XLTQNNXRAQATIC-NSHDSACASA-N |
| XLogP | 1.22 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |