C14H25N3 — CID 50949002
(E)-N-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N,2-dimethylbut-2-en-1-amine (PubChem CID 50949002) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is (E)-N-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N,2-dimethylbut-2-en-1-amine.
| Compound Name | (E)-N-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N,2-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 50949002 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (E)-N-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N,2-dimethylbut-2-en-1-amine |
| SMILES | C/C=C(\C)CN(C)Cc1cc(C(C)(C)C)n[nH]1 |
| InChI | InChI=1S/C14H25N3/c1-7-11(2)9-17(6)10-12-8-13(16-15-12)14(3,4)5/h7-8H,9-10H2,1-6H3,(H,15,16)/b11-7+ |
| InChIKey | OSBZYEYTZBOFHM-YRNVUSSQSA-N |
| XLogP | 3.11 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|